C48H32 — CID 156656832
5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylphenyl)anthracen-9-yl]-12b,12c-dihydrobenzo[c]phenanthrene (PubChem CID 156656832) has the molecular formula C48H32 and a molecular weight of 616.83 g/mol. Its IUPAC name is 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylphenyl)anthracen-9-yl]-12b,12c-dihydrobenzo[c]phenanthrene.
| Compound Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylphenyl)anthracen-9-yl]-12b,12c-dihydrobenzo[c]phenanthrene |
|---|---|
| PubChem CID | 156656832 |
| Molecular Formula | C48H32 |
| Molecular Weight | 616.83 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | 5-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-naphthalen-2-ylphenyl)anthracen-9-yl]-12b,12c-dihydrobenzo[c]phenanthrene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(-c4ccc5ccccc5c4)cc3)c3c([2H])c([2H])c([2H])c([2H])c3c(C3=C4C=CC=CC4C4C(=C3)C=Cc3ccccc34)c2c1[2H] |
| InChI | InChI=1S/C48H32/c1-2-13-35-29-36(27-23-31(35)11-1)32-21-25-34(26-22-32)46-41-17-7-9-19-43(41)48(44-20-10-8-18-42(44)46)45-30-37-28-24-33-12-3-4-14-38(33)47(37)40-16-6-5-15-39(40)45/h1-30,40,47H/i7D,8D,9D,10D,17D,18D,19D,20D |
| InChIKey | YWVHJRDRCLSLEX-GEHMGHGBSA-N |
| XLogP | 12.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.83 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|