C16H23B2NO3 — CID 156660993
methyl-[6-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]borinic acid (PubChem CID 156660993) has the molecular formula C16H23B2NO3 and a molecular weight of 298.99 g/mol. Its IUPAC name is methyl-[6-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]borinic acid.
| Compound Name | methyl-[6-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]borinic acid |
|---|---|
| PubChem CID | 156660993 |
| Molecular Formula | C16H23B2NO3 |
| Molecular Weight | 298.99 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | methyl-[6-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]borinic acid |
| SMILES | CB(O)n1cc(B2OC(C)(C)C(C)(C)O2)c2ccc(C)cc21 |
| InChI | InChI=1S/C16H23B2NO3/c1-11-7-8-12-13(10-19(17(6)20)14(12)9-11)18-21-15(2,3)16(4,5)22-18/h7-10,20H,1-6H3 |
| InChIKey | VPNVAQSLJWKAAP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.99 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|