C23H44O4Sn — CID 15666115
methyl (2E,4E)-4-(diethoxymethyl)-5-tributylstannylpenta-2,4-dienoate (PubChem CID 15666115) has the molecular formula C23H44O4Sn and a molecular weight of 503.31 g/mol. Its IUPAC name is methyl (2E,4E)-4-(diethoxymethyl)-5-tributylstannylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-4-(diethoxymethyl)-5-tributylstannylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 15666115 |
| Molecular Formula | C23H44O4Sn |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl (2E,4E)-4-(diethoxymethyl)-5-tributylstannylpenta-2,4-dienoate |
| SMILES | CCCC[Sn](/C=C(\C=C\C(=O)OC)C(OCC)OCC)(CCCC)CCCC |
| InChI | InChI=1S/C11H17O4.3C4H9.Sn/c1-5-14-11(15-6-2)9(3)7-8-10(12)13-4;3*1-3-4-2;/h3,7-8,11H,5-6H2,1-2,4H3;3*1,3-4H2,2H3;/b8-7+,9-3?;;;; |
| InChIKey | GAFWZCJRLAPECJ-NDFBXVAVSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|