C20H19N5Pt — CID 156661532
3,5-bis(1-methylimidazol-2-yl)-4H-pyridin-4-ide;methylbenzene;platinum(2+) (PubChem CID 156661532) has the molecular formula C20H19N5Pt and a molecular weight of 524.49 g/mol. Its IUPAC name is 3,5-bis(1-methylimidazol-2-yl)-4H-pyridin-4-ide;methylbenzene;platinum(2+).
| Compound Name | 3,5-bis(1-methylimidazol-2-yl)-4H-pyridin-4-ide;methylbenzene;platinum(2+) |
|---|---|
| PubChem CID | 156661532 |
| Molecular Formula | C20H19N5Pt |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 3,5-bis(1-methylimidazol-2-yl)-4H-pyridin-4-ide;methylbenzene;platinum(2+) |
| SMILES | Cc1cc[c-]cc1.Cn1ccnc1-c1[c-]c(-c2nccn2C)cnc1.[Pt+2] |
| InChI | InChI=1S/C13H12N5.C7H7.Pt/c1-17-5-3-15-12(17)10-7-11(9-14-8-10)13-16-4-6-18(13)2;1-7-5-3-2-4-6-7;/h3-6,8-9H,1-2H3;3-6H,1H3;/q2*-1;+2 |
| InChIKey | IMIJKEONDPFFLM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|