C17H13Br3O10S — CID 156666259
2-[5-oxo-2-(2,3,5-tribromobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid (PubChem CID 156666259) has the molecular formula C17H13Br3O10S and a molecular weight of 649.06 g/mol. Its IUPAC name is 2-[5-oxo-2-(2,3,5-tribromobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[5-oxo-2-(2,3,5-tribromobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 156666259 |
| Molecular Formula | C17H13Br3O10S |
| Molecular Weight | 649.06 g/mol |
| Exact Mass | 645.78 |
| IUPAC Name | 2-[5-oxo-2-(2,3,5-tribromobenzoyl)oxy-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C(OC1C2OC(=O)C3C2OC1C3C(=O)OCCS(=O)(=O)O)c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C17H13Br3O10S/c18-5-3-6(10(20)7(19)4-5)15(21)29-13-11-8(16(22)27-1-2-31(24,25)26)9-12(28-11)14(13)30-17(9)23/h3-4,8-9,11-14H,1-2H2,(H,24,25,26) |
| InChIKey | VBBGTIQHNDCBON-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.06 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|