C20H22O2S — CID 15667448
2-[[5-(3-phenylpropyl)thiophen-2-yl]methyl]cyclohexane-1,3-dione (PubChem CID 15667448) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-[[5-(3-phenylpropyl)thiophen-2-yl]methyl]cyclohexane-1,3-dione.
| Compound Name | 2-[[5-(3-phenylpropyl)thiophen-2-yl]methyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 15667448 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[[5-(3-phenylpropyl)thiophen-2-yl]methyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1Cc1ccc(CCCc2ccccc2)s1 |
| InChI | InChI=1S/C20H22O2S/c21-19-10-5-11-20(22)18(19)14-17-13-12-16(23-17)9-4-8-15-6-2-1-3-7-15/h1-3,6-7,12-13,18H,4-5,8-11,14H2 |
| InChIKey | WGRNJTXQUKBFBX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|