C18H25BrFN7O3S — CID 156675046
N'-(3-bromo-4-fluorophenyl)-4-[[3-[2-(sulfamoylamino)ethyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 156675046) has the molecular formula C18H25BrFN7O3S and a molecular weight of 518.41 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[[3-[2-(sulfamoylamino)ethyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[[3-[2-(sulfamoylamino)ethyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 156675046 |
| Molecular Formula | C18H25BrFN7O3S |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[[3-[2-(sulfamoylamino)ethyl]cyclohexyl]methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(Br)c1)c1nonc1NCC1CCCC(CCNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C18H25BrFN7O3S/c19-14-9-13(4-5-15(14)20)25-17(21)16-18(27-30-26-16)23-10-12-3-1-2-11(8-12)6-7-24-31(22,28)29/h4-5,9,11-12,24H,1-3,6-8,10H2,(H2,21,25)(H,23,27)(H2,22,28,29) |
| InChIKey | ODWLGSXQDIVCCA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 161.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|