C16H18BrFN6O3S — CID 146652669
N'-(3-bromo-4-fluorophenyl)-4-[(2-methylsulfonyl-2-azaspiro[3.3]heptan-6-yl)amino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 146652669) has the molecular formula C16H18BrFN6O3S and a molecular weight of 473.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[(2-methylsulfonyl-2-azaspiro[3.3]heptan-6-yl)amino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[(2-methylsulfonyl-2-azaspiro[3.3]heptan-6-yl)amino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 146652669 |
| Molecular Formula | C16H18BrFN6O3S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[(2-methylsulfonyl-2-azaspiro[3.3]heptan-6-yl)amino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)N1CC2(CC(Nc3nonc3/C(N)=N\c3ccc(F)c(Br)c3)C2)C1 |
| InChI | InChI=1S/C16H18BrFN6O3S/c1-28(25,26)24-7-16(8-24)5-10(6-16)21-15-13(22-27-23-15)14(19)20-9-2-3-12(18)11(17)4-9/h2-4,10H,5-8H2,1H3,(H2,19,20)(H,21,23) |
| InChIKey | NWOYYZXBXAMJFL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|