C21H34O6 — CID 156682374
3-[3-[6-(3-acetyloxypentan-3-yl)cyclohex-3-en-1-yl]pentan-3-yloxy]-3-oxopropanoic acid (PubChem CID 156682374) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-[3-[6-(3-acetyloxypentan-3-yl)cyclohex-3-en-1-yl]pentan-3-yloxy]-3-oxopropanoic acid.
| Compound Name | 3-[3-[6-(3-acetyloxypentan-3-yl)cyclohex-3-en-1-yl]pentan-3-yloxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 156682374 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 3-[3-[6-(3-acetyloxypentan-3-yl)cyclohex-3-en-1-yl]pentan-3-yloxy]-3-oxopropanoic acid |
| SMILES | CCC(CC)(OC(C)=O)C1CC=CCC1C(CC)(CC)OC(=O)CC(=O)O |
| InChI | InChI=1S/C21H34O6/c1-6-20(7-2,26-15(5)22)16-12-10-11-13-17(16)21(8-3,9-4)27-19(25)14-18(23)24/h10-11,16-17H,6-9,12-14H2,1-5H3,(H,23,24) |
| InChIKey | ZDFSEDQYWFTTBC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|