C34H61LiN4 — CID 156682909
lithium 1-[(2Z,6Z,9Z,13Z)-6-hexylidene-10-methanidyl-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine (PubChem CID 156682909) has the molecular formula C34H61LiN4 and a molecular weight of 532.83 g/mol. Its IUPAC name is lithium 1-[(2Z,6Z,9Z,13Z)-6-hexylidene-10-methanidyl-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine.
| Compound Name | lithium 1-[(2Z,6Z,9Z,13Z)-6-hexylidene-10-methanidyl-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 156682909 |
| Molecular Formula | C34H61LiN4 |
| Molecular Weight | 532.83 g/mol |
| Exact Mass | 532.51 |
| IUPAC Name | lithium 1-[(2Z,6Z,9Z,13Z)-6-hexylidene-10-methanidyl-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine |
| SMILES | [CH2-]/C(=C/CC/C(=C/CCCCC)CC/C=C(/C)CN1CCN(C)CC1)CC/C=C(/C)CN1CCN(C)CC1.[Li+] |
| InChI | InChI=1S/C34H61N4.Li/c1-7-8-9-10-18-34(20-13-17-33(4)30-38-27-23-36(6)24-28-38)19-12-15-31(2)14-11-16-32(3)29-37-25-21-35(5)22-26-37;/h15-18H,2,7-14,19-30H2,1,3-6H3;/q-1;+1/b31-15-,32-16-,33-17-,34-18-; |
| InChIKey | FMAOJHNOTPTDPR-TXHLICDCSA-N |
| XLogP | 3.99 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|