C34H61LiN4 — CID 158727079
lithium;1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine;1-methyl-4-[(2E)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine (PubChem CID 158727079) has the molecular formula C34H61LiN4 and a molecular weight of 532.83 g/mol. Its IUPAC name is lithium;1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine;1-methyl-4-[(2E)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine.
| Compound Name | lithium;1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine;1-methyl-4-[(2E)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine |
|---|---|
| PubChem CID | 158727079 |
| Molecular Formula | C34H61LiN4 |
| Molecular Weight | 532.83 g/mol |
| Exact Mass | 532.51 |
| IUPAC Name | lithium;1-[(2E,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]-4-methylpiperazine;1-methyl-4-[(2E)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine |
| SMILES | C=CC(=C)CC/C=C(\C)CN1CCN(C)CC1.[CH2-]/C(=C/CCCCC)CC/C=C(\C)CN1CCN(C)CC1.[Li+] |
| InChI | InChI=1S/C19H35N2.C15H26N2.Li/c1-5-6-7-8-10-18(2)11-9-12-19(3)17-21-15-13-20(4)14-16-21;1-5-14(2)7-6-8-15(3)13-17-11-9-16(4)10-12-17;/h10,12H,2,5-9,11,13-17H2,1,3-4H3;5,8H,1-2,6-7,9-13H2,3-4H3;/q-1;;+1/b18-10-,19-12+;15-8+; |
| InChIKey | PXBLVBVBQUPNTD-ZCYPEYHTSA-N |
| XLogP | 4.01 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|