C34H61IN4 — CID 170054241
1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine (PubChem CID 170054241) has the molecular formula C34H61IN4 and a molecular weight of 652.79 g/mol. Its IUPAC name is 1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine.
| Compound Name | 1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 170054241 |
| Molecular Formula | C34H61IN4 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.39 |
| IUPAC Name | 1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methylpiperazine |
| SMILES | CCCCC/C=C(\CC/C=C(/C)CN1CCN(C)CC1)CC/C=C(/CI)CC/C=C(/C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C34H61IN4/c1-6-7-8-9-15-33(16-10-13-31(2)29-38-24-20-36(4)21-25-38)17-12-19-34(28-35)18-11-14-32(3)30-39-26-22-37(5)23-27-39/h13-15,19H,6-12,16-18,20-30H2,1-5H3/b31-13-,32-14-,33-15+,34-19+ |
| InChIKey | AHBCZOKFIXDLCO-VIKSOCESSA-N |
| XLogP | 7.58 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|