C19H35IN2 — CID 170054233
1-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienyl]-4-methylpiperazine (PubChem CID 170054233) has the molecular formula C19H35IN2 and a molecular weight of 418.41 g/mol. Its IUPAC name is 1-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 170054233 |
| Molecular Formula | C19H35IN2 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(2Z,6E)-6-(iodomethyl)-2-methyldodeca-2,6-dienyl]-4-methylpiperazine |
| SMILES | CCCCC/C=C(/CI)CC/C=C(/C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C19H35IN2/c1-4-5-6-7-10-19(16-20)11-8-9-18(2)17-22-14-12-21(3)13-15-22/h9-10H,4-8,11-17H2,1-3H3/b18-9-,19-10+ |
| InChIKey | ZTQVLMXMAXELQI-MXYCIJPUSA-N |
| XLogP | 4.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|