C17H33N3 — CID 123343640
N,2-dimethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]octa-2,7-dien-1-amine (PubChem CID 123343640) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is N,2-dimethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]octa-2,7-dien-1-amine.
| Compound Name | N,2-dimethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]octa-2,7-dien-1-amine |
|---|---|
| PubChem CID | 123343640 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | N,2-dimethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]octa-2,7-dien-1-amine |
| SMILES | C=CCCCC=C(C)CN(C)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C17H33N3/c1-5-6-7-8-9-17(2)16-19(4)12-15-20-13-10-18(3)11-14-20/h5,9H,1,6-8,10-16H2,2-4H3 |
| InChIKey | PVLBWVPLXUEYFW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|