C22H28BrNO7S — CID 156693378
methyl 5-bromo-2-[1-[[2-(2-methoxy-2-oxoethyl)-4-methylphenyl]sulfonylamino]hexyl]furan-3-carboxylate (PubChem CID 156693378) has the molecular formula C22H28BrNO7S and a molecular weight of 530.44 g/mol. Its IUPAC name is methyl 5-bromo-2-[1-[[2-(2-methoxy-2-oxoethyl)-4-methylphenyl]sulfonylamino]hexyl]furan-3-carboxylate.
| Compound Name | methyl 5-bromo-2-[1-[[2-(2-methoxy-2-oxoethyl)-4-methylphenyl]sulfonylamino]hexyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 156693378 |
| Molecular Formula | C22H28BrNO7S |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | methyl 5-bromo-2-[1-[[2-(2-methoxy-2-oxoethyl)-4-methylphenyl]sulfonylamino]hexyl]furan-3-carboxylate |
| SMILES | CCCCCC(NS(=O)(=O)c1ccc(C)cc1CC(=O)OC)c1oc(Br)cc1C(=O)OC |
| InChI | InChI=1S/C22H28BrNO7S/c1-5-6-7-8-17(21-16(22(26)30-4)13-19(23)31-21)24-32(27,28)18-10-9-14(2)11-15(18)12-20(25)29-3/h9-11,13,17,24H,5-8,12H2,1-4H3 |
| InChIKey | HOTJQQZNIKUESZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|