C10H20N2O3 — CID 156696624
tert-butyl N-[[3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoyl]amino]carbamate (PubChem CID 156696624) has the molecular formula C10H20N2O3 and a molecular weight of 222.32 g/mol. Its IUPAC name is tert-butyl N-[[3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoyl]amino]carbamate |
|---|---|
| PubChem CID | 156696624 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | tert-butyl N-[[3,3,3-trideuterio-2-methyl-2-(trideuteriomethyl)propanoyl]amino]carbamate |
| SMILES | [2H]C([2H])([2H])C(C)(C(=O)NNC(=O)OC(C)(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H20N2O3/c1-9(2,3)7(13)11-12-8(14)15-10(4,5)6/h1-6H3,(H,11,13)(H,12,14)/i1D3,2D3 |
| InChIKey | CFXLEMZNWBHNQV-WFGJKAKNSA-N |
| XLogP | 1.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|