C21H45N3O7 — CID 156709184
2-[[amino-[(Z)-2-amino-3-[2-(2-propoxyethoxy)ethoxy]prop-1-enyl]amino]methyl]-6-methoxy-4-methyloxane-3,5-diol;propane (PubChem CID 156709184) has the molecular formula C21H45N3O7 and a molecular weight of 451.61 g/mol. Its IUPAC name is 2-[[amino-[(Z)-2-amino-3-[2-(2-propoxyethoxy)ethoxy]prop-1-enyl]amino]methyl]-6-methoxy-4-methyloxane-3,5-diol;propane.
| Compound Name | 2-[[amino-[(Z)-2-amino-3-[2-(2-propoxyethoxy)ethoxy]prop-1-enyl]amino]methyl]-6-methoxy-4-methyloxane-3,5-diol;propane |
|---|---|
| PubChem CID | 156709184 |
| Molecular Formula | C21H45N3O7 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | 2-[[amino-[(Z)-2-amino-3-[2-(2-propoxyethoxy)ethoxy]prop-1-enyl]amino]methyl]-6-methoxy-4-methyloxane-3,5-diol;propane |
| SMILES | CCC.CCCOCCOCCOC/C(N)=C/N(N)CC1OC(OC)C(O)C(C)C1O |
| InChI | InChI=1S/C18H37N3O7.C3H8/c1-4-5-25-6-7-26-8-9-27-12-14(19)10-21(20)11-15-16(22)13(2)17(23)18(24-3)28-15;1-3-2/h10,13,15-18,22-23H,4-9,11-12,19-20H2,1-3H3;3H2,1-2H3/b14-10-; |
| InChIKey | DQXBIFNJUJTHRA-DZOOLQPHSA-N |
| XLogP | 0.57 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|