C31H37F3N4O3S — CID 156712479
trans-(1R,4R)-1-N-[2-[3-(4-ethylsulfonyl-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-4-N,4-N-dimethyl-2-methylidenecyclohexane-1,4-diamine (PubChem CID 156712479) has the molecular formula C31H37F3N4O3S and a molecular weight of 602.72 g/mol. Its IUPAC name is trans-(1R,4R)-1-N-[2-[3-(4-ethylsulfonyl-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-4-N,4-N-dimethyl-2-methylidenecyclohexane-1,4-diamine.
| Compound Name | trans-(1R,4R)-1-N-[2-[3-(4-ethylsulfonyl-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-4-N,4-N-dimethyl-2-methylidenecyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 156712479 |
| Molecular Formula | C31H37F3N4O3S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | trans-(1R,4R)-1-N-[2-[3-(4-ethylsulfonyl-2-methoxyanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]-4-N,4-N-dimethyl-2-methylidenecyclohexane-1,4-diamine |
| SMILES | C=C1C[C@H](N(C)C)CC[C@H]1Nc1cccc2c1cc(C#CCNc1ccc(S(=O)(=O)CC)cc1OC)n2CC(F)(F)F |
| InChI | InChI=1S/C31H37F3N4O3S/c1-6-42(39,40)24-13-15-28(30(19-24)41-5)35-16-8-9-23-18-25-27(10-7-11-29(25)38(23)20-31(32,33)34)36-26-14-12-22(37(3)4)17-21(26)2/h7,10-11,13,15,18-19,22,26,35-36H,2,6,12,14,16-17,20H2,1,3-5H3/t22-,26-/m1/s1 |
| InChIKey | WDQVQSUJKYQEOC-ATIYNZHBSA-N |
| XLogP | 5.92 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|