C16H21F2NO3 — CID 156714647
ethane;methyl 5-[(3,5-difluorophenyl)methylamino]-2-methylidene-5-oxopentanoate (PubChem CID 156714647) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is ethane;methyl 5-[(3,5-difluorophenyl)methylamino]-2-methylidene-5-oxopentanoate.
| Compound Name | ethane;methyl 5-[(3,5-difluorophenyl)methylamino]-2-methylidene-5-oxopentanoate |
|---|---|
| PubChem CID | 156714647 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethane;methyl 5-[(3,5-difluorophenyl)methylamino]-2-methylidene-5-oxopentanoate |
| SMILES | C=C(CCC(=O)NCc1cc(F)cc(F)c1)C(=O)OC.CC |
| InChI | InChI=1S/C14H15F2NO3.C2H6/c1-9(14(19)20-2)3-4-13(18)17-8-10-5-11(15)7-12(16)6-10;1-2/h5-7H,1,3-4,8H2,2H3,(H,17,18);1-2H3 |
| InChIKey | PTTSCNSDZRFDIC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|