About propan-2-ylbenzene;yttrium
propan-2-ylbenzene;yttrium (PubChem CID 156720402) has the molecular formula C9H11Y-
and a molecular weight of 208.09 g/mol. Its IUPAC name is propan-2-ylbenzene;yttrium.
Molecular Properties
| Compound Name | propan-2-ylbenzene;yttrium |
| PubChem CID | 156720402 |
| Molecular Formula | C9H11Y- |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | propan-2-ylbenzene;yttrium |
| SMILES | [CH2-]C(C)c1ccccc1.[Y] |
| InChI | InChI=1S/C9H11.Y/c1-8(2)9-6-4-3-5-7-9;/h3-8H,1H2,2H3;/q-1; |
| InChIKey | FPPKZKBKBGVCPO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylbenzene;yttrium?
The IUPAC name of propan-2-ylbenzene;yttrium (CID 156720402) is propan-2-ylbenzene;yttrium.
What is the SMILES notation for propan-2-ylbenzene;yttrium?
The canonical SMILES for propan-2-ylbenzene;yttrium is [CH2-]C(C)c1ccccc1.[Y].
What is the InChIKey of propan-2-ylbenzene;yttrium?
The InChIKey is FPPKZKBKBGVCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11.Y/c1-8(2)9-6-4-3-5-7-9;/h3-8H,1H2,2H3;/q-1;.
What are the key properties of propan-2-ylbenzene;yttrium?
propan-2-ylbenzene;yttrium has a molecular weight of 208.09 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylbenzene;yttrium is sourced from PubChem (CID 156720402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).