C20H31BN4O3 — CID 156721359
[3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]boronic acid (PubChem CID 156721359) has the molecular formula C20H31BN4O3 and a molecular weight of 386.31 g/mol. Its IUPAC name is [3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]boronic acid.
| Compound Name | [3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 156721359 |
| Molecular Formula | C20H31BN4O3 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]boronic acid |
| SMILES | CCCC(c1nc2ccc(B(O)O)cc2c(=O)n1CC)N1CCCN(C)CC1 |
| InChI | InChI=1S/C20H31BN4O3/c1-4-7-18(24-11-6-10-23(3)12-13-24)19-22-17-9-8-15(21(27)28)14-16(17)20(26)25(19)5-2/h8-9,14,18,27-28H,4-7,10-13H2,1-3H3 |
| InChIKey | WSCFJDFVQDQTIQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|