C20H29BrN4O — CID 164617808
6-bromo-3-ethyl-2-[1-[4-(methylamino)piperidin-1-yl]butyl]quinazolin-4-one (PubChem CID 164617808) has the molecular formula C20H29BrN4O and a molecular weight of 421.38 g/mol. Its IUPAC name is 6-bromo-3-ethyl-2-[1-[4-(methylamino)piperidin-1-yl]butyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-ethyl-2-[1-[4-(methylamino)piperidin-1-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 164617808 |
| Molecular Formula | C20H29BrN4O |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 6-bromo-3-ethyl-2-[1-[4-(methylamino)piperidin-1-yl]butyl]quinazolin-4-one |
| SMILES | CCCC(c1nc2ccc(Br)cc2c(=O)n1CC)N1CCC(NC)CC1 |
| InChI | InChI=1S/C20H29BrN4O/c1-4-6-18(24-11-9-15(22-3)10-12-24)19-23-17-8-7-14(21)13-16(17)20(26)25(19)5-2/h7-8,13,15,18,22H,4-6,9-12H2,1-3H3 |
| InChIKey | WAEGUHUSNCIBOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |