C14H16Br2N2O — CID 156783706
6-bromo-2-(1-bromobutyl)-3-ethylquinazolin-4-one (PubChem CID 156783706) has the molecular formula C14H16Br2N2O and a molecular weight of 388.10 g/mol. Its IUPAC name is 6-bromo-2-(1-bromobutyl)-3-ethylquinazolin-4-one.
| Compound Name | 6-bromo-2-(1-bromobutyl)-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 156783706 |
| Molecular Formula | C14H16Br2N2O |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 6-bromo-2-(1-bromobutyl)-3-ethylquinazolin-4-one |
| SMILES | CCCC(Br)c1nc2ccc(Br)cc2c(=O)n1CC |
| InChI | InChI=1S/C14H16Br2N2O/c1-3-5-11(16)13-17-12-7-6-9(15)8-10(12)14(19)18(13)4-2/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | RPYPRPBOIHVIIZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|