C19H27BrN4O2 — CID 156783741
6-bromo-3-ethyl-2-[(1S)-1-[(3S)-3-(hydroxymethyl)piperazin-1-yl]butyl]quinazolin-4-one (PubChem CID 156783741) has the molecular formula C19H27BrN4O2 and a molecular weight of 423.36 g/mol. Its IUPAC name is 6-bromo-3-ethyl-2-[(1S)-1-[(3S)-3-(hydroxymethyl)piperazin-1-yl]butyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-ethyl-2-[(1S)-1-[(3S)-3-(hydroxymethyl)piperazin-1-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 156783741 |
| Molecular Formula | C19H27BrN4O2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 6-bromo-3-ethyl-2-[(1S)-1-[(3S)-3-(hydroxymethyl)piperazin-1-yl]butyl]quinazolin-4-one |
| SMILES | CCC[C@@H](c1nc2ccc(Br)cc2c(=O)n1CC)N1CCN[C@H](CO)C1 |
| InChI | InChI=1S/C19H27BrN4O2/c1-3-5-17(23-9-8-21-14(11-23)12-25)18-22-16-7-6-13(20)10-15(16)19(26)24(18)4-2/h6-7,10,14,17,21,25H,3-5,8-9,11-12H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | KJGQJCQIYYYXNQ-YOEHRIQHSA-N |
| XLogP | 2.29 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |