C19H26Cl2N4O — CID 156783752
6,7-dichloro-3-ethyl-2-[1-[(3S)-3-methylpiperazin-1-yl]butyl]quinazolin-4-one (PubChem CID 156783752) has the molecular formula C19H26Cl2N4O and a molecular weight of 397.35 g/mol. Its IUPAC name is 6,7-dichloro-3-ethyl-2-[1-[(3S)-3-methylpiperazin-1-yl]butyl]quinazolin-4-one.
| Compound Name | 6,7-dichloro-3-ethyl-2-[1-[(3S)-3-methylpiperazin-1-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 156783752 |
| Molecular Formula | C19H26Cl2N4O |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6,7-dichloro-3-ethyl-2-[1-[(3S)-3-methylpiperazin-1-yl]butyl]quinazolin-4-one |
| SMILES | CCCC(c1nc2cc(Cl)c(Cl)cc2c(=O)n1CC)N1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C19H26Cl2N4O/c1-4-6-17(24-8-7-22-12(3)11-24)18-23-16-10-15(21)14(20)9-13(16)19(26)25(18)5-2/h9-10,12,17,22H,4-8,11H2,1-3H3/t12-,17?/m0/s1 |
| InChIKey | RWLKKZOLUMAZKW-WHUIICBVSA-N |
| XLogP | 3.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |