C20H27BrFN3O — CID 163836084
6-bromo-3-ethyl-7-fluoro-2-[(1S)-1-[(3S)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one (PubChem CID 163836084) has the molecular formula C20H27BrFN3O and a molecular weight of 424.36 g/mol. Its IUPAC name is 6-bromo-3-ethyl-7-fluoro-2-[(1S)-1-[(3S)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-ethyl-7-fluoro-2-[(1S)-1-[(3S)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 163836084 |
| Molecular Formula | C20H27BrFN3O |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 6-bromo-3-ethyl-7-fluoro-2-[(1S)-1-[(3S)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one |
| SMILES | CCC[C@@H](c1nc2cc(F)c(Br)cc2c(=O)n1CC)N1CCC[C@H](C)C1 |
| InChI | InChI=1S/C20H27BrFN3O/c1-4-7-18(24-9-6-8-13(3)12-24)19-23-17-11-16(22)15(21)10-14(17)20(26)25(19)5-2/h10-11,13,18H,4-9,12H2,1-3H3/t13-,18-/m0/s1 |
| InChIKey | OHWGZIXGXBEUJS-UGSOOPFHSA-N |
| XLogP | 4.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |