C20H28FN3O — CID 163823148
3-ethyl-8-fluoro-2-[(1R)-1-[(3R)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one (PubChem CID 163823148) has the molecular formula C20H28FN3O and a molecular weight of 345.46 g/mol. Its IUPAC name is 3-ethyl-8-fluoro-2-[(1R)-1-[(3R)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one.
| Compound Name | 3-ethyl-8-fluoro-2-[(1R)-1-[(3R)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 163823148 |
| Molecular Formula | C20H28FN3O |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 3-ethyl-8-fluoro-2-[(1R)-1-[(3R)-3-methylpiperidin-1-yl]butyl]quinazolin-4-one |
| SMILES | CCC[C@H](c1nc2c(F)cccc2c(=O)n1CC)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C20H28FN3O/c1-4-8-17(23-12-7-9-14(3)13-23)19-22-18-15(10-6-11-16(18)21)20(25)24(19)5-2/h6,10-11,14,17H,4-5,7-9,12-13H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | NXDKEDZPZZSYJP-RHSMWYFYSA-N |
| XLogP | 4.13 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |