C20H28FN3O2 — CID 163544982
3-ethyl-8-fluoro-6-methoxy-2-[(1R)-1-piperidin-1-ylbutyl]quinazolin-4-one (PubChem CID 163544982) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is 3-ethyl-8-fluoro-6-methoxy-2-[(1R)-1-piperidin-1-ylbutyl]quinazolin-4-one.
| Compound Name | 3-ethyl-8-fluoro-6-methoxy-2-[(1R)-1-piperidin-1-ylbutyl]quinazolin-4-one |
|---|---|
| PubChem CID | 163544982 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-ethyl-8-fluoro-6-methoxy-2-[(1R)-1-piperidin-1-ylbutyl]quinazolin-4-one |
| SMILES | CCC[C@H](c1nc2c(F)cc(OC)cc2c(=O)n1CC)N1CCCCC1 |
| InChI | InChI=1S/C20H28FN3O2/c1-4-9-17(23-10-7-6-8-11-23)19-22-18-15(20(25)24(19)5-2)12-14(26-3)13-16(18)21/h12-13,17H,4-11H2,1-3H3/t17-/m1/s1 |
| InChIKey | KTOXYHZKAMLBQE-QGZVFWFLSA-N |
| XLogP | 3.89 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |