C20H31BN4O4 — CID 176719431
[3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]oxyboronic acid (PubChem CID 176719431) has the molecular formula C20H31BN4O4 and a molecular weight of 402.30 g/mol. Its IUPAC name is [3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]oxyboronic acid.
| Compound Name | [3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]oxyboronic acid |
|---|---|
| PubChem CID | 176719431 |
| Molecular Formula | C20H31BN4O4 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [3-ethyl-2-[1-(4-methyl-1,4-diazepan-1-yl)butyl]-4-oxoquinazolin-6-yl]oxyboronic acid |
| SMILES | CCCC(c1nc2ccc(OB(O)O)cc2c(=O)n1CC)N1CCCN(C)CC1 |
| InChI | InChI=1S/C20H31BN4O4/c1-4-7-18(24-11-6-10-23(3)12-13-24)19-22-17-9-8-15(29-21(27)28)14-16(17)20(26)25(19)5-2/h8-9,14,18,27-28H,4-7,10-13H2,1-3H3 |
| InChIKey | KTLOZAYLDCJENV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|