C19H27BrN4O — CID 156783667
6-bromo-3-ethyl-2-[1-(3-methylpiperazin-1-yl)butyl]quinazolin-4-one (PubChem CID 156783667) has the molecular formula C19H27BrN4O and a molecular weight of 407.36 g/mol. Its IUPAC name is 6-bromo-3-ethyl-2-[1-(3-methylpiperazin-1-yl)butyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-ethyl-2-[1-(3-methylpiperazin-1-yl)butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 156783667 |
| Molecular Formula | C19H27BrN4O |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 6-bromo-3-ethyl-2-[1-(3-methylpiperazin-1-yl)butyl]quinazolin-4-one |
| SMILES | CCCC(c1nc2ccc(Br)cc2c(=O)n1CC)N1CCNC(C)C1 |
| InChI | InChI=1S/C19H27BrN4O/c1-4-6-17(23-10-9-21-13(3)12-23)18-22-16-8-7-14(20)11-15(16)19(25)24(18)5-2/h7-8,11,13,17,21H,4-6,9-10,12H2,1-3H3 |
| InChIKey | CCSYRVYORQUIJU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |