C20H29BrN4O2 — CID 162424459
6-bromo-3-ethyl-2-[(1R)-1-[(3R)-3-(methoxymethyl)piperazin-1-yl]butyl]quinazolin-4-one (PubChem CID 162424459) has the molecular formula C20H29BrN4O2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 6-bromo-3-ethyl-2-[(1R)-1-[(3R)-3-(methoxymethyl)piperazin-1-yl]butyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-ethyl-2-[(1R)-1-[(3R)-3-(methoxymethyl)piperazin-1-yl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 162424459 |
| Molecular Formula | C20H29BrN4O2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 6-bromo-3-ethyl-2-[(1R)-1-[(3R)-3-(methoxymethyl)piperazin-1-yl]butyl]quinazolin-4-one |
| SMILES | CCC[C@H](c1nc2ccc(Br)cc2c(=O)n1CC)N1CCN[C@@H](COC)C1 |
| InChI | InChI=1S/C20H29BrN4O2/c1-4-6-18(24-10-9-22-15(12-24)13-27-3)19-23-17-8-7-14(21)11-16(17)20(26)25(19)5-2/h7-8,11,15,18,22H,4-6,9-10,12-13H2,1-3H3/t15-,18-/m1/s1 |
| InChIKey | JAMCJODODKBIGD-CRAIPNDOSA-N |
| XLogP | 2.94 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |