C21H23Cl2N3O4 — CID 156723335
tert-butyl 3-[[(2,3-dichloro-6-hydroxyphenyl)-pyridin-4-ylmethyl]carbamoyl]azetidine-1-carboxylate (PubChem CID 156723335) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is tert-butyl 3-[[(2,3-dichloro-6-hydroxyphenyl)-pyridin-4-ylmethyl]carbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(2,3-dichloro-6-hydroxyphenyl)-pyridin-4-ylmethyl]carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 156723335 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | tert-butyl 3-[[(2,3-dichloro-6-hydroxyphenyl)-pyridin-4-ylmethyl]carbamoyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)NC(c2ccncc2)c2c(O)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-21(2,3)30-20(29)26-10-13(11-26)19(28)25-18(12-6-8-24-9-7-12)16-15(27)5-4-14(22)17(16)23/h4-9,13,18,27H,10-11H2,1-3H3,(H,25,28) |
| InChIKey | JFMIEPYCGJHKNB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|