C23H36Cl2N2O5 — CID 156723042
tert-butyl pyrrolidine-1-carboxylate;N-[5-(2,3-dichloro-6-hydroxyphenyl)-5-hydroxypentyl]-N-ethylformamide (PubChem CID 156723042) has the molecular formula C23H36Cl2N2O5 and a molecular weight of 491.46 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;N-[5-(2,3-dichloro-6-hydroxyphenyl)-5-hydroxypentyl]-N-ethylformamide.
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;N-[5-(2,3-dichloro-6-hydroxyphenyl)-5-hydroxypentyl]-N-ethylformamide |
|---|---|
| PubChem CID | 156723042 |
| Molecular Formula | C23H36Cl2N2O5 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;N-[5-(2,3-dichloro-6-hydroxyphenyl)-5-hydroxypentyl]-N-ethylformamide |
| SMILES | CC(C)(C)OC(=O)N1CCCC1.CCN(C=O)CCCCC(O)c1c(O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H19Cl2NO3.C9H17NO2/c1-2-17(9-18)8-4-3-5-11(19)13-12(20)7-6-10(15)14(13)16;1-9(2,3)12-8(11)10-6-4-5-7-10/h6-7,9,11,19-20H,2-5,8H2,1H3;4-7H2,1-3H3 |
| InChIKey | MMPJRFCPALYFGY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|