C15H21N3O — CID 156731727
pyrrolidin-3-yl N-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidate (PubChem CID 156731727) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is pyrrolidin-3-yl N-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidate.
| Compound Name | pyrrolidin-3-yl N-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidate |
|---|---|
| PubChem CID | 156731727 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | pyrrolidin-3-yl N-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidate |
| SMILES | C/N=C(/OC1CCNC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H21N3O/c1-16-15(19-14-6-8-17-10-14)18-9-7-12-4-2-3-5-13(12)11-18/h2-5,14,17H,6-11H2,1H3/b16-15+ |
| InChIKey | ZIWDVXRTMRRUMG-FOCLMDBBSA-N |
| XLogP | 1.41 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|