C15H24NOPt-3 — CID 156737601
carbanide;N-(2,6-dimethylphenyl)pentanamide;platinum (PubChem CID 156737601) has the molecular formula C15H24NOPt-3 and a molecular weight of 429.44 g/mol. Its IUPAC name is carbanide;N-(2,6-dimethylphenyl)pentanamide;platinum.
| Compound Name | carbanide;N-(2,6-dimethylphenyl)pentanamide;platinum |
|---|---|
| PubChem CID | 156737601 |
| Molecular Formula | C15H24NOPt-3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | carbanide;N-(2,6-dimethylphenyl)pentanamide;platinum |
| SMILES | CCC[CH-]C(=O)Nc1c(C)cccc1C.[CH3-].[CH3-].[Pt] |
| InChI | InChI=1S/C13H18NO.2CH3.Pt/c1-4-5-9-12(15)14-13-10(2)7-6-8-11(13)3;;;/h6-9H,4-5H2,1-3H3,(H,14,15);2*1H3;/q3*-1; |
| InChIKey | PTWQHVDJGMUIKL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|