C22H25FN3O4S+ — CID 156743698
tert-butyl 4-[(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 156743698) has the molecular formula C22H25FN3O4S+ and a molecular weight of 446.52 g/mol. Its IUPAC name is tert-butyl 4-[(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156743698 |
| Molecular Formula | C22H25FN3O4S+ |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | tert-butyl 4-[(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NC2Sc3c(ccc4cc(F)ccc34)[N+]2=O)CC1 |
| InChI | InChI=1S/C22H24FN3O4S/c1-22(2,3)30-21(28)25-10-8-13(9-11-25)19(27)24-20-26(29)17-7-4-14-12-15(23)5-6-16(14)18(17)31-20/h4-7,12-13,20H,8-11H2,1-3H3/p+1 |
| InChIKey | JVOWBUSUSWOCMS-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|