C21H21FN3O3S+ — CID 156743734
cis-(1R,3S)-N-(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)-3-(prop-2-enoylamino)cyclohexane-1-carboxamide (PubChem CID 156743734) has the molecular formula C21H21FN3O3S+ and a molecular weight of 414.48 g/mol. Its IUPAC name is cis-(1R,3S)-N-(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)-3-(prop-2-enoylamino)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)-3-(prop-2-enoylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 156743734 |
| Molecular Formula | C21H21FN3O3S+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | cis-(1R,3S)-N-(7-fluoro-3-oxo-2H-benzo[g][1,3]benzothiazol-3-ium-2-yl)-3-(prop-2-enoylamino)cyclohexane-1-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@@H](C(=O)NC2Sc3c(ccc4cc(F)ccc34)[N+]2=O)C1 |
| InChI | InChI=1S/C21H20FN3O3S/c1-2-18(26)23-15-5-3-4-13(11-15)20(27)24-21-25(28)17-9-6-12-10-14(22)7-8-16(12)19(17)29-21/h2,6-10,13,15,21H,1,3-5,11H2,(H-,23,24,26,27)/p+1/t13-,15+,21?/m1/s1 |
| InChIKey | RHHGLODUDKAIPJ-DGKHWBLGSA-O |
| XLogP | 3.76 |
| TPSA | 78.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|