C14H24O4SSi — CID 156745095
methyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxythiophene-3-carboxylate (PubChem CID 156745095) has the molecular formula C14H24O4SSi and a molecular weight of 316.50 g/mol. Its IUPAC name is methyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxythiophene-3-carboxylate.
| Compound Name | methyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 156745095 |
| Molecular Formula | C14H24O4SSi |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methoxythiophene-3-carboxylate |
| SMILES | COC(=O)c1csc(CO[Si](C)(C)C(C)(C)C)c1OC |
| InChI | InChI=1S/C14H24O4SSi/c1-14(2,3)20(6,7)18-8-11-12(16-4)10(9-19-11)13(15)17-5/h9H,8H2,1-7H3 |
| InChIKey | ZACHWXIQLYTCJN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|