C35H45IO13Si — CID 45257693
methyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-iodo-3,4,5-trimethoxybenzoyl)oxy-2-methoxyphenoxy]-3,4,5-trimethoxybenzoate (PubChem CID 45257693) has the molecular formula C35H45IO13Si and a molecular weight of 828.72 g/mol. Its IUPAC name is methyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-iodo-3,4,5-trimethoxybenzoyl)oxy-2-methoxyphenoxy]-3,4,5-trimethoxybenzoate.
| Compound Name | methyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-iodo-3,4,5-trimethoxybenzoyl)oxy-2-methoxyphenoxy]-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 45257693 |
| Molecular Formula | C35H45IO13Si |
| Molecular Weight | 828.72 g/mol |
| Exact Mass | 828.17 |
| IUPAC Name | methyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-iodo-3,4,5-trimethoxybenzoyl)oxy-2-methoxyphenoxy]-3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1Oc1cc(CO[Si](C)(C)C(C)(C)C)cc(OC(=O)c2cc(OC)c(OC)c(OC)c2I)c1OC |
| InChI | InChI=1S/C35H45IO13Si/c1-35(2,3)50(12,13)47-18-19-14-24(48-27-21(33(37)46-11)17-23(40-5)30(43-8)32(27)45-10)28(41-6)25(15-19)49-34(38)20-16-22(39-4)29(42-7)31(44-9)26(20)36/h14-17H,18H2,1-13H3 |
| InChIKey | GFACOMAGFRTEAL-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 135.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.72 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|