C29H37N5O — CID 156747977
1-[3-[2-[2-(3-heptylanilino)-7-methylidenepyrido[2,3-d]pyrimidin-8-yl]ethyl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 156747977) has the molecular formula C29H37N5O and a molecular weight of 471.65 g/mol. Its IUPAC name is 1-[3-[2-[2-(3-heptylanilino)-7-methylidenepyrido[2,3-d]pyrimidin-8-yl]ethyl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-[2-(3-heptylanilino)-7-methylidenepyrido[2,3-d]pyrimidin-8-yl]ethyl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156747977 |
| Molecular Formula | C29H37N5O |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 1-[3-[2-[2-(3-heptylanilino)-7-methylidenepyrido[2,3-d]pyrimidin-8-yl]ethyl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(CCN2C(=C)C=Cc3cnc(Nc4cccc(CCCCCCC)c4)nc32)C1 |
| InChI | InChI=1S/C29H37N5O/c1-4-6-7-8-9-11-23-12-10-13-26(18-23)31-29-30-19-25-15-14-22(3)34(28(25)32-29)17-16-24-20-33(21-24)27(35)5-2/h5,10,12-15,18-19,24H,2-4,6-9,11,16-17,20-21H2,1H3,(H,30,31,32) |
| InChIKey | MZLUTFGINZCZJQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|