C13H14F4O2 — CID 156750193
4-(4-fluoro-2-methoxy-3-methylphenyl)-2-(trifluoromethyl)oxolane (PubChem CID 156750193) has the molecular formula C13H14F4O2 and a molecular weight of 278.25 g/mol. Its IUPAC name is 4-(4-fluoro-2-methoxy-3-methylphenyl)-2-(trifluoromethyl)oxolane.
| Compound Name | 4-(4-fluoro-2-methoxy-3-methylphenyl)-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 156750193 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-(4-fluoro-2-methoxy-3-methylphenyl)-2-(trifluoromethyl)oxolane |
| SMILES | COc1c(C2COC(C(F)(F)F)C2)ccc(F)c1C |
| InChI | InChI=1S/C13H14F4O2/c1-7-10(14)4-3-9(12(7)18-2)8-5-11(19-6-8)13(15,16)17/h3-4,8,11H,5-6H2,1-2H3 |
| InChIKey | CZZNXUMKJOBWBF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |