C13H15F4O2P — CID 177218396
[[4-(3,4-difluoro-2-methoxyphenyl)-3-methyloxolan-2-yl]-difluoromethyl]phosphane (PubChem CID 177218396) has the molecular formula C13H15F4O2P and a molecular weight of 310.23 g/mol. Its IUPAC name is [[4-(3,4-difluoro-2-methoxyphenyl)-3-methyloxolan-2-yl]-difluoromethyl]phosphane.
| Compound Name | [[4-(3,4-difluoro-2-methoxyphenyl)-3-methyloxolan-2-yl]-difluoromethyl]phosphane |
|---|---|
| PubChem CID | 177218396 |
| Molecular Formula | C13H15F4O2P |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [[4-(3,4-difluoro-2-methoxyphenyl)-3-methyloxolan-2-yl]-difluoromethyl]phosphane |
| SMILES | COc1c(C2COC(C(F)(F)P)C2C)ccc(F)c1F |
| InChI | InChI=1S/C13H15F4O2P/c1-6-8(5-19-12(6)13(16,17)20)7-3-4-9(14)10(15)11(7)18-2/h3-4,6,8,12H,5,20H2,1-2H3 |
| InChIKey | JWOWOELVFDNPBQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|