C21H22F5N3O4 — CID 156750321
(2S,3R,4R)-4-(2-ethoxy-3,4-difluorophenyl)-3-methyl-2-(trifluoromethyl)oxolane;4-formamidopyridine-2-carboxamide (PubChem CID 156750321) has the molecular formula C21H22F5N3O4 and a molecular weight of 475.41 g/mol. Its IUPAC name is (2S,3R,4R)-4-(2-ethoxy-3,4-difluorophenyl)-3-methyl-2-(trifluoromethyl)oxolane;4-formamidopyridine-2-carboxamide.
| Compound Name | (2S,3R,4R)-4-(2-ethoxy-3,4-difluorophenyl)-3-methyl-2-(trifluoromethyl)oxolane;4-formamidopyridine-2-carboxamide |
|---|---|
| PubChem CID | 156750321 |
| Molecular Formula | C21H22F5N3O4 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2S,3R,4R)-4-(2-ethoxy-3,4-difluorophenyl)-3-methyl-2-(trifluoromethyl)oxolane;4-formamidopyridine-2-carboxamide |
| SMILES | CCOc1c([C@@H]2CO[C@H](C(F)(F)F)[C@@H]2C)ccc(F)c1F.NC(=O)c1cc(NC=O)ccn1 |
| InChI | InChI=1S/C14H15F5O2.C7H7N3O2/c1-3-20-12-8(4-5-10(15)11(12)16)9-6-21-13(7(9)2)14(17,18)19;8-7(12)6-3-5(10-4-11)1-2-9-6/h4-5,7,9,13H,3,6H2,1-2H3;1-4H,(H2,8,12)(H,9,10,11)/t7-,9-,13+;/m1./s1 |
| InChIKey | CIEHUVUOJCDPQZ-CTWKQVAXSA-N |
| XLogP | 3.79 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|