C39H27N9O6 — CID 156756861
2,4,6-trinitro-1-N,3-N,5-N-tris(4-pyridin-3-ylphenyl)benzene-1,3,5-triamine (PubChem CID 156756861) has the molecular formula C39H27N9O6 and a molecular weight of 717.70 g/mol. Its IUPAC name is 2,4,6-trinitro-1-N,3-N,5-N-tris(4-pyridin-3-ylphenyl)benzene-1,3,5-triamine.
| Compound Name | 2,4,6-trinitro-1-N,3-N,5-N-tris(4-pyridin-3-ylphenyl)benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 156756861 |
| Molecular Formula | C39H27N9O6 |
| Molecular Weight | 717.70 g/mol |
| Exact Mass | 717.21 |
| IUPAC Name | 2,4,6-trinitro-1-N,3-N,5-N-tris(4-pyridin-3-ylphenyl)benzene-1,3,5-triamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(-c3cccnc3)cc2)c([N+](=O)[O-])c(Nc2ccc(-c3cccnc3)cc2)c([N+](=O)[O-])c1Nc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C39H27N9O6/c49-46(50)37-34(43-31-13-7-25(8-14-31)28-4-1-19-40-22-28)38(47(51)52)36(45-33-17-11-27(12-18-33)30-6-3-21-42-24-30)39(48(53)54)35(37)44-32-15-9-26(10-16-32)29-5-2-20-41-23-29/h1-24,43-45H |
| InChIKey | XQJHCGPKPRACSJ-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 204.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.70 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|