C21H15N3O2 — CID 156767035
N-[3-[5-(2-phenylethynyl)pyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 156767035) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[3-[5-(2-phenylethynyl)pyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[5-(2-phenylethynyl)pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156767035 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[3-[5-(2-phenylethynyl)pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2ncncc2C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H15N3O2/c1-2-20(25)24-18-9-6-10-19(13-18)26-21-17(14-22-15-23-21)12-11-16-7-4-3-5-8-16/h2-10,13-15H,1H2,(H,24,25) |
| InChIKey | QSXIKIZRCSXOMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|