C17H17N3O2 — CID 156771354
[2-(7-propylpyrrolo[2,3-d]pyrimidin-4-yl)phenyl] acetate (PubChem CID 156771354) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is [2-(7-propylpyrrolo[2,3-d]pyrimidin-4-yl)phenyl] acetate.
| Compound Name | [2-(7-propylpyrrolo[2,3-d]pyrimidin-4-yl)phenyl] acetate |
|---|---|
| PubChem CID | 156771354 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [2-(7-propylpyrrolo[2,3-d]pyrimidin-4-yl)phenyl] acetate |
| SMILES | CCCn1ccc2c(-c3ccccc3OC(C)=O)ncnc21 |
| InChI | InChI=1S/C17H17N3O2/c1-3-9-20-10-8-14-16(18-11-19-17(14)20)13-6-4-5-7-15(13)22-12(2)21/h4-8,10-11H,3,9H2,1-2H3 |
| InChIKey | FCNCEOSYFWMTQE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|