2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid

C9H14O4S2 — CID 156775639

IUPAC2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid
SMILESCC(C)OC(=O)C(C(=O)O)C1SCCS1
InChIInChI=1S/C9H14O4S2/c1-5(2)13-8(12)6(7(10)11)9-14-3-4-15-9/h5-6,9H,3-4H2,1-2H3,(H,10,11)
InChIKeyAKJYLMXEYURZIN-UHFFFAOYSA-N
MW250.34 g/mol
LogP1.44
Rot. Bonds4

About 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid

2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid (PubChem CID 156775639) has the molecular formula C9H14O4S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid.

Molecular Properties

Compound Name2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid
PubChem CID156775639
Molecular FormulaC9H14O4S2
Molecular Weight250.34 g/mol
Exact Mass250.03
IUPAC Name2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid
SMILESCC(C)OC(=O)C(C(=O)O)C1SCCS1
InChIInChI=1S/C9H14O4S2/c1-5(2)13-8(12)6(7(10)11)9-14-3-4-15-9/h5-6,9H,3-4H2,1-2H3,(H,10,11)
InChIKeyAKJYLMXEYURZIN-UHFFFAOYSA-N
XLogP1.44
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.34
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid?
The IUPAC name of 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid (CID 156775639) is 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid.
What is the SMILES notation for 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid?
The canonical SMILES for 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid is CC(C)OC(=O)C(C(=O)O)C1SCCS1.
What is the InChIKey of 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid?
The InChIKey is AKJYLMXEYURZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S2/c1-5(2)13-8(12)6(7(10)11)9-14-3-4-15-9/h5-6,9H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid?
2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid has a molecular weight of 250.34 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid is sourced from PubChem (CID 156775639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).