C9H14O4S2 — CID 156775639
2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid (PubChem CID 156775639) has the molecular formula C9H14O4S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid.
| Compound Name | 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid |
|---|---|
| PubChem CID | 156775639 |
| Molecular Formula | C9H14O4S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2-(1,3-dithiolan-2-yl)-3-oxo-3-propan-2-yloxypropanoic acid |
| SMILES | CC(C)OC(=O)C(C(=O)O)C1SCCS1 |
| InChI | InChI=1S/C9H14O4S2/c1-5(2)13-8(12)6(7(10)11)9-14-3-4-15-9/h5-6,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | AKJYLMXEYURZIN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|