C14H22O4S2 — CID 174633649
1-O-[1-(1,3-dithiolan-2-yl)ethenyl] 3-O-propan-2-yl 2-propan-2-ylpropanedioate (PubChem CID 174633649) has the molecular formula C14H22O4S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-O-[1-(1,3-dithiolan-2-yl)ethenyl] 3-O-propan-2-yl 2-propan-2-ylpropanedioate.
| Compound Name | 1-O-[1-(1,3-dithiolan-2-yl)ethenyl] 3-O-propan-2-yl 2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 174633649 |
| Molecular Formula | C14H22O4S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-O-[1-(1,3-dithiolan-2-yl)ethenyl] 3-O-propan-2-yl 2-propan-2-ylpropanedioate |
| SMILES | C=C(OC(=O)C(C(=O)OC(C)C)C(C)C)C1SCCS1 |
| InChI | InChI=1S/C14H22O4S2/c1-8(2)11(12(15)17-9(3)4)13(16)18-10(5)14-19-6-7-20-14/h8-9,11,14H,5-7H2,1-4H3 |
| InChIKey | QMJCMQHRSDXETB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|