C8H6O2S — CID 156776515
2-ethynyl-5-sulfonylcyclohexa-1,3-diene (PubChem CID 156776515) has the molecular formula C8H6O2S and a molecular weight of 166.20 g/mol. Its IUPAC name is 2-ethynyl-5-sulfonylcyclohexa-1,3-diene.
| Compound Name | 2-ethynyl-5-sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 156776515 |
| Molecular Formula | C8H6O2S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 2-ethynyl-5-sulfonylcyclohexa-1,3-diene |
| SMILES | C#CC1=CCC(=S(=O)=O)C=C1 |
| InChI | InChI=1S/C8H6O2S/c1-2-7-3-5-8(6-4-7)11(9)10/h1,3-5H,6H2 |
| InChIKey | LMWBGJLBDXLXLV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|