C10H7NO4S — CID 139644347
1-(4-sulfonylcyclohexa-1,5-dien-1-yl)pyrrole-2,5-dione (PubChem CID 139644347) has the molecular formula C10H7NO4S and a molecular weight of 237.24 g/mol. Its IUPAC name is 1-(4-sulfonylcyclohexa-1,5-dien-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(4-sulfonylcyclohexa-1,5-dien-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139644347 |
| Molecular Formula | C10H7NO4S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 1-(4-sulfonylcyclohexa-1,5-dien-1-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1=CCC(=S(=O)=O)C=C1 |
| InChI | InChI=1S/C10H7NO4S/c12-9-5-6-10(13)11(9)7-1-3-8(4-2-7)16(14)15/h1-3,5-6H,4H2 |
| InChIKey | WGKJINRWXVMPEI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|